C21H15FOS — CID 145312797
4-[3-fluoro-4-[2-(4-methoxyphenyl)ethynyl]phenyl]benzenethiol (PubChem CID 145312797) has the molecular formula C21H15FOS and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-[3-fluoro-4-[2-(4-methoxyphenyl)ethynyl]phenyl]benzenethiol.
| Compound Name | 4-[3-fluoro-4-[2-(4-methoxyphenyl)ethynyl]phenyl]benzenethiol |
|---|---|
| PubChem CID | 145312797 |
| Molecular Formula | C21H15FOS |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 4-[3-fluoro-4-[2-(4-methoxyphenyl)ethynyl]phenyl]benzenethiol |
| SMILES | COc1ccc(C#Cc2ccc(-c3ccc(S)cc3)cc2F)cc1 |
| InChI | InChI=1S/C21H15FOS/c1-23-19-10-3-15(4-11-19)2-5-17-6-7-18(14-21(17)22)16-8-12-20(24)13-9-16/h3-4,6-14,24H,1H3 |
| InChIKey | LGXVJAQOSNPGCI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|