C26H17F3O — CID 139858391
2,3-difluoro-6-[2-[2-fluoro-4-[4-(methoxymethyl)phenyl]phenyl]ethynyl]naphthalene (PubChem CID 139858391) has the molecular formula C26H17F3O and a molecular weight of 402.42 g/mol. Its IUPAC name is 2,3-difluoro-6-[2-[2-fluoro-4-[4-(methoxymethyl)phenyl]phenyl]ethynyl]naphthalene.
| Compound Name | 2,3-difluoro-6-[2-[2-fluoro-4-[4-(methoxymethyl)phenyl]phenyl]ethynyl]naphthalene |
|---|---|
| PubChem CID | 139858391 |
| Molecular Formula | C26H17F3O |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 2,3-difluoro-6-[2-[2-fluoro-4-[4-(methoxymethyl)phenyl]phenyl]ethynyl]naphthalene |
| SMILES | COCc1ccc(-c2ccc(C#Cc3ccc4cc(F)c(F)cc4c3)c(F)c2)cc1 |
| InChI | InChI=1S/C26H17F3O/c1-30-16-18-4-6-19(7-5-18)21-11-10-20(24(27)13-21)8-2-17-3-9-22-14-25(28)26(29)15-23(22)12-17/h3-7,9-15H,16H2,1H3 |
| InChIKey | BLOYCCYRBPWYMD-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|