C27H18F4O — CID 139858832
1,2,3-trifluoro-6-[2-[2-fluoro-4-[4-(2-methoxyethyl)phenyl]phenyl]ethynyl]naphthalene (PubChem CID 139858832) has the molecular formula C27H18F4O and a molecular weight of 434.43 g/mol. Its IUPAC name is 1,2,3-trifluoro-6-[2-[2-fluoro-4-[4-(2-methoxyethyl)phenyl]phenyl]ethynyl]naphthalene.
| Compound Name | 1,2,3-trifluoro-6-[2-[2-fluoro-4-[4-(2-methoxyethyl)phenyl]phenyl]ethynyl]naphthalene |
|---|---|
| PubChem CID | 139858832 |
| Molecular Formula | C27H18F4O |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 1,2,3-trifluoro-6-[2-[2-fluoro-4-[4-(2-methoxyethyl)phenyl]phenyl]ethynyl]naphthalene |
| SMILES | COCCc1ccc(-c2ccc(C#Cc3ccc4c(F)c(F)c(F)cc4c3)c(F)c2)cc1 |
| InChI | InChI=1S/C27H18F4O/c1-32-13-12-17-2-6-19(7-3-17)21-10-9-20(24(28)15-21)8-4-18-5-11-23-22(14-18)16-25(29)27(31)26(23)30/h2-3,5-7,9-11,14-16H,12-13H2,1H3 |
| InChIKey | PVOLKCCJUVPORX-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|