C30H20F4 — CID 139859425
6-[2-[4-[2-(4-butylphenyl)ethynyl]-2-fluorophenyl]ethynyl]-1,2,3-trifluoronaphthalene (PubChem CID 139859425) has the molecular formula C30H20F4 and a molecular weight of 456.48 g/mol. Its IUPAC name is 6-[2-[4-[2-(4-butylphenyl)ethynyl]-2-fluorophenyl]ethynyl]-1,2,3-trifluoronaphthalene.
| Compound Name | 6-[2-[4-[2-(4-butylphenyl)ethynyl]-2-fluorophenyl]ethynyl]-1,2,3-trifluoronaphthalene |
|---|---|
| PubChem CID | 139859425 |
| Molecular Formula | C30H20F4 |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 6-[2-[4-[2-(4-butylphenyl)ethynyl]-2-fluorophenyl]ethynyl]-1,2,3-trifluoronaphthalene |
| SMILES | CCCCc1ccc(C#Cc2ccc(C#Cc3ccc4c(F)c(F)c(F)cc4c3)c(F)c2)cc1 |
| InChI | InChI=1S/C30H20F4/c1-2-3-4-20-5-7-21(8-6-20)9-10-23-12-15-24(27(31)18-23)14-11-22-13-16-26-25(17-22)19-28(32)30(34)29(26)33/h5-8,12-13,15-19H,2-4H2,1H3 |
| InChIKey | SSBSSKYKBZIOJQ-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|