C30H23F5 — CID 139857235
6-[2-[4-[2-(4-butyl-2,6-difluorophenyl)ethyl]phenyl]ethynyl]-1,2,3-trifluoronaphthalene (PubChem CID 139857235) has the molecular formula C30H23F5 and a molecular weight of 478.50 g/mol. Its IUPAC name is 6-[2-[4-[2-(4-butyl-2,6-difluorophenyl)ethyl]phenyl]ethynyl]-1,2,3-trifluoronaphthalene.
| Compound Name | 6-[2-[4-[2-(4-butyl-2,6-difluorophenyl)ethyl]phenyl]ethynyl]-1,2,3-trifluoronaphthalene |
|---|---|
| PubChem CID | 139857235 |
| Molecular Formula | C30H23F5 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 6-[2-[4-[2-(4-butyl-2,6-difluorophenyl)ethyl]phenyl]ethynyl]-1,2,3-trifluoronaphthalene |
| SMILES | CCCCc1cc(F)c(CCc2ccc(C#Cc3ccc4c(F)c(F)c(F)cc4c3)cc2)c(F)c1 |
| InChI | InChI=1S/C30H23F5/c1-2-3-4-22-16-26(31)25(27(32)17-22)14-11-20-7-5-19(6-8-20)9-10-21-12-13-24-23(15-21)18-28(33)30(35)29(24)34/h5-8,12-13,15-18H,2-4,11,14H2,1H3 |
| InChIKey | BIWMRQHETDOQRB-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|