C28H18F6 — CID 139847008
6-[4-[2-(4-butyl-2-fluorophenyl)ethynyl]-2,6-difluorophenyl]-1,2,3-trifluoronaphthalene (PubChem CID 139847008) has the molecular formula C28H18F6 and a molecular weight of 468.44 g/mol. Its IUPAC name is 6-[4-[2-(4-butyl-2-fluorophenyl)ethynyl]-2,6-difluorophenyl]-1,2,3-trifluoronaphthalene.
| Compound Name | 6-[4-[2-(4-butyl-2-fluorophenyl)ethynyl]-2,6-difluorophenyl]-1,2,3-trifluoronaphthalene |
|---|---|
| PubChem CID | 139847008 |
| Molecular Formula | C28H18F6 |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 6-[4-[2-(4-butyl-2-fluorophenyl)ethynyl]-2,6-difluorophenyl]-1,2,3-trifluoronaphthalene |
| SMILES | CCCCc1ccc(C#Cc2cc(F)c(-c3ccc4c(F)c(F)c(F)cc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C28H18F6/c1-2-3-4-16-5-7-18(22(29)11-16)8-6-17-12-23(30)26(24(31)13-17)19-9-10-21-20(14-19)15-25(32)28(34)27(21)33/h5,7,9-15H,2-4H2,1H3 |
| InChIKey | KLKCJIGVSQDTOP-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|