C32H20F10O — CID 129036603
2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-1,3-difluoro-5-[2-(2-fluoro-4-pentylphenyl)ethynyl]benzene (PubChem CID 129036603) has the molecular formula C32H20F10O and a molecular weight of 610.49 g/mol. Its IUPAC name is 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-1,3-difluoro-5-[2-(2-fluoro-4-pentylphenyl)ethynyl]benzene.
| Compound Name | 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-1,3-difluoro-5-[2-(2-fluoro-4-pentylphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 129036603 |
| Molecular Formula | C32H20F10O |
| Molecular Weight | 610.49 g/mol |
| Exact Mass | 610.14 |
| IUPAC Name | 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-1,3-difluoro-5-[2-(2-fluoro-4-pentylphenyl)ethynyl]benzene |
| SMILES | CCCCCc1ccc(C#Cc2cc(F)c(-c3cc(F)c(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C32H20F10O/c1-2-3-4-5-17-6-8-19(22(33)10-17)9-7-18-11-23(34)29(24(35)12-18)20-13-25(36)30(26(37)14-20)32(41,42)43-21-15-27(38)31(40)28(39)16-21/h6,8,10-16H,2-5H2,1H3 |
| InChIKey | PWOUJJRQQLEEFK-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.49 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|