C33H22F10O — CID 129036736
2-[[4-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethynyl]-3-fluorophenoxy]-difluoromethyl]-1,3-difluoro-5-(4-pentylphenyl)benzene (PubChem CID 129036736) has the molecular formula C33H22F10O and a molecular weight of 624.52 g/mol. Its IUPAC name is 2-[[4-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethynyl]-3-fluorophenoxy]-difluoromethyl]-1,3-difluoro-5-(4-pentylphenyl)benzene.
| Compound Name | 2-[[4-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethynyl]-3-fluorophenoxy]-difluoromethyl]-1,3-difluoro-5-(4-pentylphenyl)benzene |
|---|---|
| PubChem CID | 129036736 |
| Molecular Formula | C33H22F10O |
| Molecular Weight | 624.52 g/mol |
| Exact Mass | 624.15 |
| IUPAC Name | 2-[[4-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethynyl]-3-fluorophenoxy]-difluoromethyl]-1,3-difluoro-5-(4-pentylphenyl)benzene |
| SMILES | CCCCCc1ccc(-c2cc(F)c(C(F)(F)Oc3ccc(C#Cc4cc(F)c(C(F)(F)F)c(F)c4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C33H22F10O/c1-2-3-4-5-19-6-9-21(10-7-19)23-16-28(37)31(29(38)17-23)33(42,43)44-24-13-12-22(25(34)18-24)11-8-20-14-26(35)30(27(36)15-20)32(39,40)41/h6-7,9-10,12-18H,2-5H2,1H3 |
| InChIKey | LCHQSLOIIHARTD-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.52 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|