C29H16F8O2 — CID 129036487
2-[difluoro-[3-fluoro-4-[2-(3,4,5-trifluorophenyl)ethynyl]phenoxy]methyl]-5-(4-ethoxyphenyl)-1,3-difluorobenzene (PubChem CID 129036487) has the molecular formula C29H16F8O2 and a molecular weight of 548.43 g/mol. Its IUPAC name is 2-[difluoro-[3-fluoro-4-[2-(3,4,5-trifluorophenyl)ethynyl]phenoxy]methyl]-5-(4-ethoxyphenyl)-1,3-difluorobenzene.
| Compound Name | 2-[difluoro-[3-fluoro-4-[2-(3,4,5-trifluorophenyl)ethynyl]phenoxy]methyl]-5-(4-ethoxyphenyl)-1,3-difluorobenzene |
|---|---|
| PubChem CID | 129036487 |
| Molecular Formula | C29H16F8O2 |
| Molecular Weight | 548.43 g/mol |
| Exact Mass | 548.10 |
| IUPAC Name | 2-[difluoro-[3-fluoro-4-[2-(3,4,5-trifluorophenyl)ethynyl]phenoxy]methyl]-5-(4-ethoxyphenyl)-1,3-difluorobenzene |
| SMILES | CCOc1ccc(-c2cc(F)c(C(F)(F)Oc3ccc(C#Cc4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C29H16F8O2/c1-2-38-20-8-5-17(6-9-20)19-13-23(31)27(24(32)14-19)29(36,37)39-21-10-7-18(22(30)15-21)4-3-16-11-25(33)28(35)26(34)12-16/h5-15H,2H2,1H3 |
| InChIKey | CBJTYYFPHQDVSP-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.43 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|