C31H16F10O — CID 129037440
5-but-3-enyl-2-[4-[difluoro-[3-fluoro-4-[2-(3,4,5-trifluorophenyl)ethynyl]phenoxy]methyl]-3,5-difluorophenyl]-1,3-difluorobenzene (PubChem CID 129037440) has the molecular formula C31H16F10O and a molecular weight of 594.45 g/mol. Its IUPAC name is 5-but-3-enyl-2-[4-[difluoro-[3-fluoro-4-[2-(3,4,5-trifluorophenyl)ethynyl]phenoxy]methyl]-3,5-difluorophenyl]-1,3-difluorobenzene.
| Compound Name | 5-but-3-enyl-2-[4-[difluoro-[3-fluoro-4-[2-(3,4,5-trifluorophenyl)ethynyl]phenoxy]methyl]-3,5-difluorophenyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 129037440 |
| Molecular Formula | C31H16F10O |
| Molecular Weight | 594.45 g/mol |
| Exact Mass | 594.10 |
| IUPAC Name | 5-but-3-enyl-2-[4-[difluoro-[3-fluoro-4-[2-(3,4,5-trifluorophenyl)ethynyl]phenoxy]methyl]-3,5-difluorophenyl]-1,3-difluorobenzene |
| SMILES | C=CCCc1cc(F)c(-c2cc(F)c(C(F)(F)Oc3ccc(C#Cc4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C31H16F10O/c1-2-3-4-16-9-22(33)28(23(34)10-16)19-13-24(35)29(25(36)14-19)31(40,41)42-20-8-7-18(21(32)15-20)6-5-17-11-26(37)30(39)27(38)12-17/h2,7-15H,1,3-4H2 |
| InChIKey | YJHRTJKRRTUZPE-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.45 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|