C31H18F10O — CID 137445755
5-[2-(4-but-3-enyl-2-fluorophenyl)ethynyl]-2-[4-[difluoro-(3,4,5-trifluorocyclohexa-1,5-dien-1-yl)oxymethyl]-3,5-difluorophenyl]-1,3-difluorobenzene (PubChem CID 137445755) has the molecular formula C31H18F10O and a molecular weight of 596.46 g/mol. Its IUPAC name is 5-[2-(4-but-3-enyl-2-fluorophenyl)ethynyl]-2-[4-[difluoro-(3,4,5-trifluorocyclohexa-1,5-dien-1-yl)oxymethyl]-3,5-difluorophenyl]-1,3-difluorobenzene.
| Compound Name | 5-[2-(4-but-3-enyl-2-fluorophenyl)ethynyl]-2-[4-[difluoro-(3,4,5-trifluorocyclohexa-1,5-dien-1-yl)oxymethyl]-3,5-difluorophenyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 137445755 |
| Molecular Formula | C31H18F10O |
| Molecular Weight | 596.46 g/mol |
| Exact Mass | 596.12 |
| IUPAC Name | 5-[2-(4-but-3-enyl-2-fluorophenyl)ethynyl]-2-[4-[difluoro-(3,4,5-trifluorocyclohexa-1,5-dien-1-yl)oxymethyl]-3,5-difluorophenyl]-1,3-difluorobenzene |
| SMILES | C=CCCc1ccc(C#Cc2cc(F)c(-c3cc(F)c(C(F)(F)OC4=CC(F)C(F)C(F)=C4)c(F)c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C31H18F10O/c1-2-3-4-16-5-7-18(21(32)9-16)8-6-17-10-22(33)28(23(34)11-17)19-12-24(35)29(25(36)13-19)31(40,41)42-20-14-26(37)30(39)27(38)15-20/h2,5,7,9-15,26,30H,1,3-4H2 |
| InChIKey | FOTUWNFISURRRJ-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.46 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|