C31H17F9O — CID 129036266
5-(4-but-3-enylphenyl)-2-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-1,3-difluorobenzene (PubChem CID 129036266) has the molecular formula C31H17F9O and a molecular weight of 576.46 g/mol. Its IUPAC name is 5-(4-but-3-enylphenyl)-2-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-1,3-difluorobenzene.
| Compound Name | 5-(4-but-3-enylphenyl)-2-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 129036266 |
| Molecular Formula | C31H17F9O |
| Molecular Weight | 576.46 g/mol |
| Exact Mass | 576.11 |
| IUPAC Name | 5-(4-but-3-enylphenyl)-2-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-1,3-difluorobenzene |
| SMILES | C=CCCc1ccc(-c2cc(F)c(C#Cc3cc(F)c(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C31H17F9O/c1-2-3-4-17-5-8-19(9-6-17)20-13-23(32)22(24(33)14-20)10-7-18-11-25(34)29(26(35)12-18)31(39,40)41-21-15-27(36)30(38)28(37)16-21/h2,5-6,8-9,11-16H,1,3-4H2 |
| InChIKey | ZLJVVBRPHMCGAC-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.46 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|