C30H17F7O2 — CID 129037412
2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluoro-5-[2-[4-(4-prop-2-enoxyphenyl)phenyl]ethynyl]benzene (PubChem CID 129037412) has the molecular formula C30H17F7O2 and a molecular weight of 542.45 g/mol. Its IUPAC name is 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluoro-5-[2-[4-(4-prop-2-enoxyphenyl)phenyl]ethynyl]benzene.
| Compound Name | 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluoro-5-[2-[4-(4-prop-2-enoxyphenyl)phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 129037412 |
| Molecular Formula | C30H17F7O2 |
| Molecular Weight | 542.45 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluoro-5-[2-[4-(4-prop-2-enoxyphenyl)phenyl]ethynyl]benzene |
| SMILES | C=CCOc1ccc(-c2ccc(C#Cc3cc(F)c(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C30H17F7O2/c1-2-13-38-22-11-9-21(10-12-22)20-7-5-18(6-8-20)3-4-19-14-24(31)28(25(32)15-19)30(36,37)39-23-16-26(33)29(35)27(34)17-23/h2,5-12,14-17H,1,13H2 |
| InChIKey | YEZYZOZGCUHLPU-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.45 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|