C29H15F9O2 — CID 129036769
2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-5-[2-[4-(4-ethoxyphenyl)-2,6-difluorophenyl]ethynyl]-1,3-difluorobenzene (PubChem CID 129036769) has the molecular formula C29H15F9O2 and a molecular weight of 566.42 g/mol. Its IUPAC name is 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-5-[2-[4-(4-ethoxyphenyl)-2,6-difluorophenyl]ethynyl]-1,3-difluorobenzene.
| Compound Name | 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-5-[2-[4-(4-ethoxyphenyl)-2,6-difluorophenyl]ethynyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 129036769 |
| Molecular Formula | C29H15F9O2 |
| Molecular Weight | 566.42 g/mol |
| Exact Mass | 566.09 |
| IUPAC Name | 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-5-[2-[4-(4-ethoxyphenyl)-2,6-difluorophenyl]ethynyl]-1,3-difluorobenzene |
| SMILES | CCOc1ccc(-c2cc(F)c(C#Cc3cc(F)c(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C29H15F9O2/c1-2-39-18-6-4-16(5-7-18)17-11-21(30)20(22(31)12-17)8-3-15-9-23(32)27(24(33)10-15)29(37,38)40-19-13-25(34)28(36)26(35)14-19/h4-7,9-14H,2H2,1H3 |
| InChIKey | FTHZQXVZUTWDOZ-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.42 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|