C32H14F10O2 — CID 129036450
2-[[4-[2-[3,5-difluoro-4-[2-(3,4,5-trifluorophenyl)ethynyl]phenyl]ethynyl]-3-fluorophenoxy]-difluoromethyl]-1,3-difluoro-5-prop-2-enoxybenzene (PubChem CID 129036450) has the molecular formula C32H14F10O2 and a molecular weight of 620.44 g/mol. Its IUPAC name is 2-[[4-[2-[3,5-difluoro-4-[2-(3,4,5-trifluorophenyl)ethynyl]phenyl]ethynyl]-3-fluorophenoxy]-difluoromethyl]-1,3-difluoro-5-prop-2-enoxybenzene.
| Compound Name | 2-[[4-[2-[3,5-difluoro-4-[2-(3,4,5-trifluorophenyl)ethynyl]phenyl]ethynyl]-3-fluorophenoxy]-difluoromethyl]-1,3-difluoro-5-prop-2-enoxybenzene |
|---|---|
| PubChem CID | 129036450 |
| Molecular Formula | C32H14F10O2 |
| Molecular Weight | 620.44 g/mol |
| Exact Mass | 620.08 |
| IUPAC Name | 2-[[4-[2-[3,5-difluoro-4-[2-(3,4,5-trifluorophenyl)ethynyl]phenyl]ethynyl]-3-fluorophenoxy]-difluoromethyl]-1,3-difluoro-5-prop-2-enoxybenzene |
| SMILES | C=CCOc1cc(F)c(C(F)(F)Oc2ccc(C#Cc3cc(F)c(C#Cc4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C32H14F10O2/c1-2-9-43-21-15-26(36)30(27(37)16-21)32(41,42)44-20-7-6-19(23(33)14-20)5-3-17-10-24(34)22(25(35)11-17)8-4-18-12-28(38)31(40)29(39)13-18/h2,6-7,10-16H,1,9H2 |
| InChIKey | FWSFYZOVMLCERD-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.44 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|