C24H13F7O2 — CID 129036243
5-[difluoro-[2-fluoro-4-[2-(2-fluoro-4-prop-2-enoxyphenyl)ethynyl]phenyl]methoxy]-1,2,3-trifluorobenzene (PubChem CID 129036243) has the molecular formula C24H13F7O2 and a molecular weight of 466.35 g/mol. Its IUPAC name is 5-[difluoro-[2-fluoro-4-[2-(2-fluoro-4-prop-2-enoxyphenyl)ethynyl]phenyl]methoxy]-1,2,3-trifluorobenzene.
| Compound Name | 5-[difluoro-[2-fluoro-4-[2-(2-fluoro-4-prop-2-enoxyphenyl)ethynyl]phenyl]methoxy]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 129036243 |
| Molecular Formula | C24H13F7O2 |
| Molecular Weight | 466.35 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 5-[difluoro-[2-fluoro-4-[2-(2-fluoro-4-prop-2-enoxyphenyl)ethynyl]phenyl]methoxy]-1,2,3-trifluorobenzene |
| SMILES | C=CCOc1ccc(C#Cc2ccc(C(F)(F)Oc3cc(F)c(F)c(F)c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C24H13F7O2/c1-2-9-32-16-7-6-15(19(25)11-16)5-3-14-4-8-18(20(26)10-14)24(30,31)33-17-12-21(27)23(29)22(28)13-17/h2,4,6-8,10-13H,1,9H2 |
| InChIKey | GFLXTFLNUSDXQO-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.35 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|