C30H16F8O2 — CID 129036686
5-[difluoro-[2-fluoro-4-[2-(4-prop-2-enoxyphenyl)ethynyl]phenyl]methoxy]-1,3-difluoro-2-(3,4,5-trifluorophenyl)benzene (PubChem CID 129036686) has the molecular formula C30H16F8O2 and a molecular weight of 560.44 g/mol. Its IUPAC name is 5-[difluoro-[2-fluoro-4-[2-(4-prop-2-enoxyphenyl)ethynyl]phenyl]methoxy]-1,3-difluoro-2-(3,4,5-trifluorophenyl)benzene.
| Compound Name | 5-[difluoro-[2-fluoro-4-[2-(4-prop-2-enoxyphenyl)ethynyl]phenyl]methoxy]-1,3-difluoro-2-(3,4,5-trifluorophenyl)benzene |
|---|---|
| PubChem CID | 129036686 |
| Molecular Formula | C30H16F8O2 |
| Molecular Weight | 560.44 g/mol |
| Exact Mass | 560.10 |
| IUPAC Name | 5-[difluoro-[2-fluoro-4-[2-(4-prop-2-enoxyphenyl)ethynyl]phenyl]methoxy]-1,3-difluoro-2-(3,4,5-trifluorophenyl)benzene |
| SMILES | C=CCOc1ccc(C#Cc2ccc(C(F)(F)Oc3cc(F)c(-c4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C30H16F8O2/c1-2-11-39-20-8-5-17(6-9-20)3-4-18-7-10-22(23(31)12-18)30(37,38)40-21-15-24(32)28(25(33)16-21)19-13-26(34)29(36)27(35)14-19/h2,5-10,12-16H,1,11H2 |
| InChIKey | BYORGFOHCPFWRW-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.44 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|