C30H20F6O2P2 — CID 144975610
[5-[difluoro-[2-fluoro-4-[2-fluoro-4-[2-(4-prop-2-enoxyphenyl)ethynyl]phenyl]-6-phosphanylphenyl]methoxy]-2,3-difluorophenyl]phosphane (PubChem CID 144975610) has the molecular formula C30H20F6O2P2 and a molecular weight of 588.42 g/mol. Its IUPAC name is [5-[difluoro-[2-fluoro-4-[2-fluoro-4-[2-(4-prop-2-enoxyphenyl)ethynyl]phenyl]-6-phosphanylphenyl]methoxy]-2,3-difluorophenyl]phosphane.
| Compound Name | [5-[difluoro-[2-fluoro-4-[2-fluoro-4-[2-(4-prop-2-enoxyphenyl)ethynyl]phenyl]-6-phosphanylphenyl]methoxy]-2,3-difluorophenyl]phosphane |
|---|---|
| PubChem CID | 144975610 |
| Molecular Formula | C30H20F6O2P2 |
| Molecular Weight | 588.42 g/mol |
| Exact Mass | 588.08 |
| IUPAC Name | [5-[difluoro-[2-fluoro-4-[2-fluoro-4-[2-(4-prop-2-enoxyphenyl)ethynyl]phenyl]-6-phosphanylphenyl]methoxy]-2,3-difluorophenyl]phosphane |
| SMILES | C=CCOc1ccc(C#Cc2ccc(-c3cc(F)c(C(F)(F)Oc4cc(F)c(F)c(P)c4)c(P)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C30H20F6O2P2/c1-2-11-37-20-8-5-17(6-9-20)3-4-18-7-10-22(23(31)12-18)19-13-24(32)28(26(39)14-19)30(35,36)38-21-15-25(33)29(34)27(40)16-21/h2,5-10,12-16H,1,11,39-40H2 |
| InChIKey | BROGFMBXUWCLGP-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.42 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|