C26H16F7OP — CID 134374990
[2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluoro-5-[2-fluoro-4-(4-methylphenyl)phenyl]phenyl]phosphane (PubChem CID 134374990) has the molecular formula C26H16F7OP and a molecular weight of 508.37 g/mol. Its IUPAC name is [2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluoro-5-[2-fluoro-4-(4-methylphenyl)phenyl]phenyl]phosphane.
| Compound Name | [2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluoro-5-[2-fluoro-4-(4-methylphenyl)phenyl]phenyl]phosphane |
|---|---|
| PubChem CID | 134374990 |
| Molecular Formula | C26H16F7OP |
| Molecular Weight | 508.37 g/mol |
| Exact Mass | 508.08 |
| IUPAC Name | [2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-fluoro-5-[2-fluoro-4-(4-methylphenyl)phenyl]phenyl]phosphane |
| SMILES | Cc1ccc(-c2ccc(-c3cc(F)c(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(P)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C26H16F7OP/c1-13-2-4-14(5-3-13)15-6-7-18(19(27)8-15)16-9-20(28)24(23(35)10-16)26(32,33)34-17-11-21(29)25(31)22(30)12-17/h2-12H,35H2,1H3 |
| InChIKey | YFDVFFXCEWQJMC-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.37 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|