C25H14F7OP — CID 129130663
[4-[[2,6-difluoro-4-(2-fluoro-4-phenylphenyl)phenyl]-difluoromethoxy]-2,6-difluorophenyl]phosphane (PubChem CID 129130663) has the molecular formula C25H14F7OP and a molecular weight of 494.35 g/mol. Its IUPAC name is [4-[[2,6-difluoro-4-(2-fluoro-4-phenylphenyl)phenyl]-difluoromethoxy]-2,6-difluorophenyl]phosphane.
| Compound Name | [4-[[2,6-difluoro-4-(2-fluoro-4-phenylphenyl)phenyl]-difluoromethoxy]-2,6-difluorophenyl]phosphane |
|---|---|
| PubChem CID | 129130663 |
| Molecular Formula | C25H14F7OP |
| Molecular Weight | 494.35 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | [4-[[2,6-difluoro-4-(2-fluoro-4-phenylphenyl)phenyl]-difluoromethoxy]-2,6-difluorophenyl]phosphane |
| SMILES | Fc1cc(-c2ccccc2)ccc1-c1cc(F)c(C(F)(F)Oc2cc(F)c(P)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C25H14F7OP/c26-18-8-14(13-4-2-1-3-5-13)6-7-17(18)15-9-19(27)23(20(28)10-15)25(31,32)33-16-11-21(29)24(34)22(30)12-16/h1-12H,34H2 |
| InChIKey | QLYUKDTWASMQIO-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.35 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|