C27H18F8O — CID 144768956
2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluoro-5-(2-fluoro-4-phenylphenyl)benzene;ethane (PubChem CID 144768956) has the molecular formula C27H18F8O and a molecular weight of 510.42 g/mol. Its IUPAC name is 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluoro-5-(2-fluoro-4-phenylphenyl)benzene;ethane.
| Compound Name | 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluoro-5-(2-fluoro-4-phenylphenyl)benzene;ethane |
|---|---|
| PubChem CID | 144768956 |
| Molecular Formula | C27H18F8O |
| Molecular Weight | 510.42 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluoro-5-(2-fluoro-4-phenylphenyl)benzene;ethane |
| SMILES | CC.Fc1cc(-c2ccccc2)ccc1-c1cc(F)c(C(F)(F)Oc2cc(F)c(F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C25H12F8O.C2H6/c26-18-8-14(13-4-2-1-3-5-13)6-7-17(18)15-9-19(27)23(20(28)10-15)25(32,33)34-16-11-21(29)24(31)22(30)12-16;1-2/h1-12H;1-2H3 |
| InChIKey | CBIZFJOHBSEUDP-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.42 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|