C29H14F7IO — CID 138458885
6-[[2,6-difluoro-4-(2-fluoro-4-phenylphenyl)phenyl]-difluoromethoxy]-1,3-difluoro-2-iodonaphthalene (PubChem CID 138458885) has the molecular formula C29H14F7IO and a molecular weight of 638.32 g/mol. Its IUPAC name is 6-[[2,6-difluoro-4-(2-fluoro-4-phenylphenyl)phenyl]-difluoromethoxy]-1,3-difluoro-2-iodonaphthalene.
| Compound Name | 6-[[2,6-difluoro-4-(2-fluoro-4-phenylphenyl)phenyl]-difluoromethoxy]-1,3-difluoro-2-iodonaphthalene |
|---|---|
| PubChem CID | 138458885 |
| Molecular Formula | C29H14F7IO |
| Molecular Weight | 638.32 g/mol |
| Exact Mass | 638.00 |
| IUPAC Name | 6-[[2,6-difluoro-4-(2-fluoro-4-phenylphenyl)phenyl]-difluoromethoxy]-1,3-difluoro-2-iodonaphthalene |
| SMILES | Fc1cc(-c2ccccc2)ccc1-c1cc(F)c(C(F)(F)Oc2ccc3c(F)c(I)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C29H14F7IO/c30-22-11-16(15-4-2-1-3-5-15)6-8-20(22)18-12-23(31)26(24(32)13-18)29(35,36)38-19-7-9-21-17(10-19)14-25(33)28(37)27(21)34/h1-14H |
| InChIKey | OEGWMYRLAGOKAE-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.32 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|