C26H17F7O — CID 134554711
6-[4-[(2,6-difluoro-4-propylphenyl)-difluoromethoxy]phenyl]-1,2,3-trifluoronaphthalene (PubChem CID 134554711) has the molecular formula C26H17F7O and a molecular weight of 478.41 g/mol. Its IUPAC name is 6-[4-[(2,6-difluoro-4-propylphenyl)-difluoromethoxy]phenyl]-1,2,3-trifluoronaphthalene.
| Compound Name | 6-[4-[(2,6-difluoro-4-propylphenyl)-difluoromethoxy]phenyl]-1,2,3-trifluoronaphthalene |
|---|---|
| PubChem CID | 134554711 |
| Molecular Formula | C26H17F7O |
| Molecular Weight | 478.41 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 6-[4-[(2,6-difluoro-4-propylphenyl)-difluoromethoxy]phenyl]-1,2,3-trifluoronaphthalene |
| SMILES | CCCc1cc(F)c(C(F)(F)Oc2ccc(-c3ccc4c(F)c(F)c(F)cc4c3)cc2)c(F)c1 |
| InChI | InChI=1S/C26H17F7O/c1-2-3-14-10-20(27)23(21(28)11-14)26(32,33)34-18-7-4-15(5-8-18)16-6-9-19-17(12-16)13-22(29)25(31)24(19)30/h4-13H,2-3H2,1H3 |
| InChIKey | HNSMREDJJCDTEA-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.41 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|