C22H18F6O — CID 139854272
6-[difluoro-(2-fluoro-4-pentylphenyl)methoxy]-1,2,3-trifluoronaphthalene (PubChem CID 139854272) has the molecular formula C22H18F6O and a molecular weight of 412.37 g/mol. Its IUPAC name is 6-[difluoro-(2-fluoro-4-pentylphenyl)methoxy]-1,2,3-trifluoronaphthalene.
| Compound Name | 6-[difluoro-(2-fluoro-4-pentylphenyl)methoxy]-1,2,3-trifluoronaphthalene |
|---|---|
| PubChem CID | 139854272 |
| Molecular Formula | C22H18F6O |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 6-[difluoro-(2-fluoro-4-pentylphenyl)methoxy]-1,2,3-trifluoronaphthalene |
| SMILES | CCCCCc1ccc(C(F)(F)Oc2ccc3c(F)c(F)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C22H18F6O/c1-2-3-4-5-13-6-9-17(18(23)10-13)22(27,28)29-15-7-8-16-14(11-15)12-19(24)21(26)20(16)25/h6-12H,2-5H2,1H3 |
| InChIKey | ZPRQVXVBJDBLBE-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|