C21H18F8O2 — CID 90293801
5-[difluoro-(2-fluoro-4-pentylphenyl)methoxy]-1,3-difluoro-2-[(E)-3,3,3-trifluoroprop-1-enoxy]benzene (PubChem CID 90293801) has the molecular formula C21H18F8O2 and a molecular weight of 454.36 g/mol. Its IUPAC name is 5-[difluoro-(2-fluoro-4-pentylphenyl)methoxy]-1,3-difluoro-2-[(E)-3,3,3-trifluoroprop-1-enoxy]benzene.
| Compound Name | 5-[difluoro-(2-fluoro-4-pentylphenyl)methoxy]-1,3-difluoro-2-[(E)-3,3,3-trifluoroprop-1-enoxy]benzene |
|---|---|
| PubChem CID | 90293801 |
| Molecular Formula | C21H18F8O2 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 5-[difluoro-(2-fluoro-4-pentylphenyl)methoxy]-1,3-difluoro-2-[(E)-3,3,3-trifluoroprop-1-enoxy]benzene |
| SMILES | CCCCCc1ccc(C(F)(F)Oc2cc(F)c(O/C=C/C(F)(F)F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C21H18F8O2/c1-2-3-4-5-13-6-7-15(16(22)10-13)21(28,29)31-14-11-17(23)19(18(24)12-14)30-9-8-20(25,26)27/h6-12H,2-5H2,1H3/b9-8+ |
| InChIKey | RWLNLTGINYGTMX-CMDGGOBGSA-N |
| XLogP | 7.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|