C21H18ClF7O2 — CID 123883725
1-chloro-5-[(2,6-difluoro-4-pentylphenyl)-difluoromethoxy]-2-(3,3-difluoroprop-1-enoxy)-3-fluorobenzene (PubChem CID 123883725) has the molecular formula C21H18ClF7O2 and a molecular weight of 470.81 g/mol. Its IUPAC name is 1-chloro-5-[(2,6-difluoro-4-pentylphenyl)-difluoromethoxy]-2-(3,3-difluoroprop-1-enoxy)-3-fluorobenzene.
| Compound Name | 1-chloro-5-[(2,6-difluoro-4-pentylphenyl)-difluoromethoxy]-2-(3,3-difluoroprop-1-enoxy)-3-fluorobenzene |
|---|---|
| PubChem CID | 123883725 |
| Molecular Formula | C21H18ClF7O2 |
| Molecular Weight | 470.81 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 1-chloro-5-[(2,6-difluoro-4-pentylphenyl)-difluoromethoxy]-2-(3,3-difluoroprop-1-enoxy)-3-fluorobenzene |
| SMILES | CCCCCc1cc(F)c(C(F)(F)Oc2cc(F)c(OC=CC(F)F)c(Cl)c2)c(F)c1 |
| InChI | InChI=1S/C21H18ClF7O2/c1-2-3-4-5-12-8-15(23)19(16(24)9-12)21(28,29)31-13-10-14(22)20(17(25)11-13)30-7-6-18(26)27/h6-11,18H,2-5H2,1H3 |
| InChIKey | MTPJMGGEFCZZIZ-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.81 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|