C33H25F9O2 — CID 123990446
2-[[4-(3,3-difluoroprop-1-enoxy)-3,5-difluorophenoxy]-difluoromethyl]-1,3-difluoro-5-[2-fluoro-4-(4-pentylphenyl)phenyl]benzene (PubChem CID 123990446) has the molecular formula C33H25F9O2 and a molecular weight of 624.54 g/mol. Its IUPAC name is 2-[[4-(3,3-difluoroprop-1-enoxy)-3,5-difluorophenoxy]-difluoromethyl]-1,3-difluoro-5-[2-fluoro-4-(4-pentylphenyl)phenyl]benzene.
| Compound Name | 2-[[4-(3,3-difluoroprop-1-enoxy)-3,5-difluorophenoxy]-difluoromethyl]-1,3-difluoro-5-[2-fluoro-4-(4-pentylphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 123990446 |
| Molecular Formula | C33H25F9O2 |
| Molecular Weight | 624.54 g/mol |
| Exact Mass | 624.17 |
| IUPAC Name | 2-[[4-(3,3-difluoroprop-1-enoxy)-3,5-difluorophenoxy]-difluoromethyl]-1,3-difluoro-5-[2-fluoro-4-(4-pentylphenyl)phenyl]benzene |
| SMILES | CCCCCc1ccc(-c2ccc(-c3cc(F)c(C(F)(F)Oc4cc(F)c(OC=CC(F)F)c(F)c4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C33H25F9O2/c1-2-3-4-5-19-6-8-20(9-7-19)21-10-11-24(25(34)14-21)22-15-26(35)31(27(36)16-22)33(41,42)44-23-17-28(37)32(29(38)18-23)43-13-12-30(39)40/h6-18,30H,2-5H2,1H3 |
| InChIKey | KZGITGPKQQYHKM-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.54 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|