C32H30F8O3 — CID 123940415
2-[4-[4-[[4-(3,3-difluoroprop-1-enoxy)-3,5-difluorophenoxy]-difluoromethyl]-3,5-difluorophenyl]phenyl]-5-pentyloxane (PubChem CID 123940415) has the molecular formula C32H30F8O3 and a molecular weight of 614.57 g/mol. Its IUPAC name is 2-[4-[4-[[4-(3,3-difluoroprop-1-enoxy)-3,5-difluorophenoxy]-difluoromethyl]-3,5-difluorophenyl]phenyl]-5-pentyloxane.
| Compound Name | 2-[4-[4-[[4-(3,3-difluoroprop-1-enoxy)-3,5-difluorophenoxy]-difluoromethyl]-3,5-difluorophenyl]phenyl]-5-pentyloxane |
|---|---|
| PubChem CID | 123940415 |
| Molecular Formula | C32H30F8O3 |
| Molecular Weight | 614.57 g/mol |
| Exact Mass | 614.21 |
| IUPAC Name | 2-[4-[4-[[4-(3,3-difluoroprop-1-enoxy)-3,5-difluorophenoxy]-difluoromethyl]-3,5-difluorophenyl]phenyl]-5-pentyloxane |
| SMILES | CCCCCC1CCC(c2ccc(-c3cc(F)c(C(F)(F)Oc4cc(F)c(OC=CC(F)F)c(F)c4)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/C32H30F8O3/c1-2-3-4-5-19-6-11-28(42-18-19)21-9-7-20(8-10-21)22-14-24(33)30(25(34)15-22)32(39,40)43-23-16-26(35)31(27(36)17-23)41-13-12-29(37)38/h7-10,12-17,19,28-29H,2-6,11,18H2,1H3 |
| InChIKey | GNAJBBOLSDTEQH-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.57 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|