C32H29F9O3 — CID 90293857
2-[4-[4-[[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enoxy]phenoxy]-difluoromethyl]-3,5-difluorophenyl]phenyl]-5-pentyloxane (PubChem CID 90293857) has the molecular formula C32H29F9O3 and a molecular weight of 632.56 g/mol. Its IUPAC name is 2-[4-[4-[[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enoxy]phenoxy]-difluoromethyl]-3,5-difluorophenyl]phenyl]-5-pentyloxane.
| Compound Name | 2-[4-[4-[[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enoxy]phenoxy]-difluoromethyl]-3,5-difluorophenyl]phenyl]-5-pentyloxane |
|---|---|
| PubChem CID | 90293857 |
| Molecular Formula | C32H29F9O3 |
| Molecular Weight | 632.56 g/mol |
| Exact Mass | 632.20 |
| IUPAC Name | 2-[4-[4-[[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enoxy]phenoxy]-difluoromethyl]-3,5-difluorophenyl]phenyl]-5-pentyloxane |
| SMILES | CCCCCC1CCC(c2ccc(-c3cc(F)c(C(F)(F)Oc4cc(F)c(O/C=C/C(F)(F)F)c(F)c4)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/C32H29F9O3/c1-2-3-4-5-19-6-11-28(43-18-19)21-9-7-20(8-10-21)22-14-24(33)29(25(34)15-22)32(40,41)44-23-16-26(35)30(27(36)17-23)42-13-12-31(37,38)39/h7-10,12-17,19,28H,2-6,11,18H2,1H3/b13-12+ |
| InChIKey | CEHDYAMYOHYFRG-OUKQBFOZSA-N |
| XLogP | 10.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.56 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|