C28H25F7O2 — CID 146254642
2-[4-[4-[difluoro-(2,3,4-trifluoro-6-methylphenoxy)methyl]-3,5-difluorophenyl]phenyl]-5-propyloxane (PubChem CID 146254642) has the molecular formula C28H25F7O2 and a molecular weight of 526.49 g/mol. Its IUPAC name is 2-[4-[4-[difluoro-(2,3,4-trifluoro-6-methylphenoxy)methyl]-3,5-difluorophenyl]phenyl]-5-propyloxane.
| Compound Name | 2-[4-[4-[difluoro-(2,3,4-trifluoro-6-methylphenoxy)methyl]-3,5-difluorophenyl]phenyl]-5-propyloxane |
|---|---|
| PubChem CID | 146254642 |
| Molecular Formula | C28H25F7O2 |
| Molecular Weight | 526.49 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | 2-[4-[4-[difluoro-(2,3,4-trifluoro-6-methylphenoxy)methyl]-3,5-difluorophenyl]phenyl]-5-propyloxane |
| SMILES | CCCC1CCC(c2ccc(-c3cc(F)c(C(F)(F)Oc4c(C)cc(F)c(F)c4F)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/C28H25F7O2/c1-3-4-16-5-10-23(36-14-16)18-8-6-17(7-9-18)19-12-20(29)24(21(30)13-19)28(34,35)37-27-15(2)11-22(31)25(32)26(27)33/h6-9,11-13,16,23H,3-5,10,14H2,1-2H3 |
| InChIKey | OVNNPNIJCDWPAU-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.49 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|