C24H25F7O2 — CID 140842991
2-[4-[difluoro-(3,4,5-trifluoro-2-methylphenoxy)methyl]-3,5-difluorophenyl]-5-pentyloxane (PubChem CID 140842991) has the molecular formula C24H25F7O2 and a molecular weight of 478.45 g/mol. Its IUPAC name is 2-[4-[difluoro-(3,4,5-trifluoro-2-methylphenoxy)methyl]-3,5-difluorophenyl]-5-pentyloxane.
| Compound Name | 2-[4-[difluoro-(3,4,5-trifluoro-2-methylphenoxy)methyl]-3,5-difluorophenyl]-5-pentyloxane |
|---|---|
| PubChem CID | 140842991 |
| Molecular Formula | C24H25F7O2 |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 2-[4-[difluoro-(3,4,5-trifluoro-2-methylphenoxy)methyl]-3,5-difluorophenyl]-5-pentyloxane |
| SMILES | CCCCCC1CCC(c2cc(F)c(C(F)(F)Oc3cc(F)c(F)c(F)c3C)c(F)c2)OC1 |
| InChI | InChI=1S/C24H25F7O2/c1-3-4-5-6-14-7-8-19(32-12-14)15-9-16(25)21(17(26)10-15)24(30,31)33-20-11-18(27)23(29)22(28)13(20)2/h9-11,14,19H,3-8,12H2,1-2H3 |
| InChIKey | XBAIIBJNSLSSBG-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|