C37H32F8O2 — CID 76660506
2-[4-[4-[3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]-3,5-difluorophenyl]phenyl]-5-pentyloxane (PubChem CID 76660506) has the molecular formula C37H32F8O2 and a molecular weight of 660.65 g/mol. Its IUPAC name is 2-[4-[4-[3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]-3,5-difluorophenyl]phenyl]-5-pentyloxane.
| Compound Name | 2-[4-[4-[3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]-3,5-difluorophenyl]phenyl]-5-pentyloxane |
|---|---|
| PubChem CID | 76660506 |
| Molecular Formula | C37H32F8O2 |
| Molecular Weight | 660.65 g/mol |
| Exact Mass | 660.23 |
| IUPAC Name | 2-[4-[4-[3,3-difluoro-3-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]prop-1-enyl]-3,5-difluorophenyl]phenyl]-5-pentyloxane |
| SMILES | CCCCCC1CCC(c2ccc(-c3cc(F)c(C=CC(F)(F)Oc4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/C37H32F8O2/c1-2-3-4-5-22-6-13-35(46-21-22)24-9-7-23(8-10-24)25-16-30(38)29(31(39)17-25)14-15-37(44,45)47-27-11-12-28(32(40)20-27)26-18-33(41)36(43)34(42)19-26/h7-12,14-20,22,35H,2-6,13,21H2,1H3 |
| InChIKey | GAFKLROOBKAPPS-UHFFFAOYSA-N |
| XLogP | 11.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.65 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|