C32H38F6O — CID 21353276
5-[4-[(E)-1,1-difluoro-3-[4-(4-pentylcyclohexyl)cyclohexyl]prop-2-enoxy]-2-fluorophenyl]-1,2,3-trifluorobenzene (PubChem CID 21353276) has the molecular formula C32H38F6O and a molecular weight of 552.64 g/mol. Its IUPAC name is 5-[4-[(E)-1,1-difluoro-3-[4-(4-pentylcyclohexyl)cyclohexyl]prop-2-enoxy]-2-fluorophenyl]-1,2,3-trifluorobenzene.
| Compound Name | 5-[4-[(E)-1,1-difluoro-3-[4-(4-pentylcyclohexyl)cyclohexyl]prop-2-enoxy]-2-fluorophenyl]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 21353276 |
| Molecular Formula | C32H38F6O |
| Molecular Weight | 552.64 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | 5-[4-[(E)-1,1-difluoro-3-[4-(4-pentylcyclohexyl)cyclohexyl]prop-2-enoxy]-2-fluorophenyl]-1,2,3-trifluorobenzene |
| SMILES | CCCCCC1CCC(C2CCC(/C=C/C(F)(F)Oc3ccc(-c4cc(F)c(F)c(F)c4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C32H38F6O/c1-2-3-4-5-21-6-10-23(11-7-21)24-12-8-22(9-13-24)16-17-32(37,38)39-26-14-15-27(28(33)20-26)25-18-29(34)31(36)30(35)19-25/h14-24H,2-13H2,1H3/b17-16+ |
| InChIKey | PWNXYTHACOLNOZ-WUKNDPDISA-N |
| XLogP | 10.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.64 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|