C36H36F8O3 — CID 58077439
2-[4-[4-[(E)-3,3-difluoro-3-(3,4,5-trifluorophenoxy)prop-1-enyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-(4-pentylcyclohexyl)-1,3-dioxane (PubChem CID 58077439) has the molecular formula C36H36F8O3 and a molecular weight of 668.67 g/mol. Its IUPAC name is 2-[4-[4-[(E)-3,3-difluoro-3-(3,4,5-trifluorophenoxy)prop-1-enyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-(4-pentylcyclohexyl)-1,3-dioxane.
| Compound Name | 2-[4-[4-[(E)-3,3-difluoro-3-(3,4,5-trifluorophenoxy)prop-1-enyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-(4-pentylcyclohexyl)-1,3-dioxane |
|---|---|
| PubChem CID | 58077439 |
| Molecular Formula | C36H36F8O3 |
| Molecular Weight | 668.67 g/mol |
| Exact Mass | 668.25 |
| IUPAC Name | 2-[4-[4-[(E)-3,3-difluoro-3-(3,4,5-trifluorophenoxy)prop-1-enyl]-3,5-difluorophenyl]-3-fluorophenyl]-5-(4-pentylcyclohexyl)-1,3-dioxane |
| SMILES | CCCCCC1CCC(C2COC(c3ccc(-c4cc(F)c(/C=C/C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)OC2)CC1 |
| InChI | InChI=1S/C36H36F8O3/c1-2-3-4-5-21-6-8-22(9-7-21)25-19-45-35(46-20-25)23-10-11-27(29(37)14-23)24-15-30(38)28(31(39)16-24)12-13-36(43,44)47-26-17-32(40)34(42)33(41)18-26/h10-18,21-22,25,35H,2-9,19-20H2,1H3/b13-12+ |
| InChIKey | UXXXWRUVAJOVRL-OUKQBFOZSA-N |
| XLogP | 10.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.67 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|