C27H22F8O3 — CID 58362062
5-butyl-2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]-1,3-dioxane (PubChem CID 58362062) has the molecular formula C27H22F8O3 and a molecular weight of 546.45 g/mol. Its IUPAC name is 5-butyl-2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]-1,3-dioxane.
| Compound Name | 5-butyl-2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 58362062 |
| Molecular Formula | C27H22F8O3 |
| Molecular Weight | 546.45 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | 5-butyl-2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]-1,3-dioxane |
| SMILES | CCCCC1COC(c2ccc(-c3cc(F)c(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C27H22F8O3/c1-2-3-4-14-12-36-26(37-13-14)15-5-6-18(19(28)7-15)16-8-20(29)24(21(30)9-16)27(34,35)38-17-10-22(31)25(33)23(32)11-17/h5-11,14,26H,2-4,12-13H2,1H3 |
| InChIKey | ULJOHCDWRMCMMO-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.45 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|