C32H26F8N2O3 — CID 58383523
2-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-5-(5-pentyl-1,3-dioxan-2-yl)pyrimidine (PubChem CID 58383523) has the molecular formula C32H26F8N2O3 and a molecular weight of 638.56 g/mol. Its IUPAC name is 2-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-5-(5-pentyl-1,3-dioxan-2-yl)pyrimidine.
| Compound Name | 2-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-5-(5-pentyl-1,3-dioxan-2-yl)pyrimidine |
|---|---|
| PubChem CID | 58383523 |
| Molecular Formula | C32H26F8N2O3 |
| Molecular Weight | 638.56 g/mol |
| Exact Mass | 638.18 |
| IUPAC Name | 2-[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-5-(5-pentyl-1,3-dioxan-2-yl)pyrimidine |
| SMILES | CCCCCC1COC(c2cnc(-c3cc(F)c(C(F)(F)Oc4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)nc2)OC1 |
| InChI | InChI=1S/C32H26F8N2O3/c1-2-3-4-5-17-15-43-31(44-16-17)20-13-41-30(42-14-20)19-10-24(34)28(25(35)11-19)32(39,40)45-21-6-7-22(23(33)12-21)18-8-26(36)29(38)27(37)9-18/h6-14,17,31H,2-5,15-16H2,1H3 |
| InChIKey | CCXGRRAJUGTOLQ-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.56 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|