C29H24F10O4 — CID 89280495
2-[[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenoxy]-difluoromethyl]-5-pentyl-1,3-dioxane (PubChem CID 89280495) has the molecular formula C29H24F10O4 and a molecular weight of 626.49 g/mol. Its IUPAC name is 2-[[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenoxy]-difluoromethyl]-5-pentyl-1,3-dioxane.
| Compound Name | 2-[[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenoxy]-difluoromethyl]-5-pentyl-1,3-dioxane |
|---|---|
| PubChem CID | 89280495 |
| Molecular Formula | C29H24F10O4 |
| Molecular Weight | 626.49 g/mol |
| Exact Mass | 626.15 |
| IUPAC Name | 2-[[4-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenoxy]-difluoromethyl]-5-pentyl-1,3-dioxane |
| SMILES | CCCCCC1COC(C(F)(F)Oc2cc(F)c(C(F)(F)Oc3ccc(-c4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C29H24F10O4/c1-2-3-4-5-15-13-40-27(41-14-15)29(38,39)43-18-11-21(31)25(22(32)12-18)28(36,37)42-17-6-7-19(20(30)10-17)16-8-23(33)26(35)24(34)9-16/h6-12,15,27H,2-5,13-14H2,1H3 |
| InChIKey | ZZYWIVZGEYUQIU-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.49 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|