C36H32F8O3 — CID 59329518
2-[4-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]phenyl]-5-heptyl-1,3-dioxane (PubChem CID 59329518) has the molecular formula C36H32F8O3 and a molecular weight of 664.63 g/mol. Its IUPAC name is 2-[4-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]phenyl]-5-heptyl-1,3-dioxane.
| Compound Name | 2-[4-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]phenyl]-5-heptyl-1,3-dioxane |
|---|---|
| PubChem CID | 59329518 |
| Molecular Formula | C36H32F8O3 |
| Molecular Weight | 664.63 g/mol |
| Exact Mass | 664.22 |
| IUPAC Name | 2-[4-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]phenyl]-5-heptyl-1,3-dioxane |
| SMILES | CCCCCCCC1COC(c2ccc(-c3ccc(-c4cc(F)c(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/C36H32F8O3/c1-2-3-4-5-6-7-21-19-45-35(46-20-21)23-10-8-22(9-11-23)24-12-13-27(28(37)14-24)25-15-29(38)33(30(39)16-25)36(43,44)47-26-17-31(40)34(42)32(41)18-26/h8-18,21,35H,2-7,19-20H2,1H3 |
| InChIKey | NXJIQWWSUUASLJ-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.63 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|