C35H29F9O4 — CID 59330138
2-[4-[4-[[3,5-difluoro-4-[(3,4,5-trifluorophenyl)methoxy]phenoxy]-difluoromethyl]-3,5-difluorophenyl]phenyl]-5-pentyl-1,3-dioxane (PubChem CID 59330138) has the molecular formula C35H29F9O4 and a molecular weight of 684.60 g/mol. Its IUPAC name is 2-[4-[4-[[3,5-difluoro-4-[(3,4,5-trifluorophenyl)methoxy]phenoxy]-difluoromethyl]-3,5-difluorophenyl]phenyl]-5-pentyl-1,3-dioxane.
| Compound Name | 2-[4-[4-[[3,5-difluoro-4-[(3,4,5-trifluorophenyl)methoxy]phenoxy]-difluoromethyl]-3,5-difluorophenyl]phenyl]-5-pentyl-1,3-dioxane |
|---|---|
| PubChem CID | 59330138 |
| Molecular Formula | C35H29F9O4 |
| Molecular Weight | 684.60 g/mol |
| Exact Mass | 684.19 |
| IUPAC Name | 2-[4-[4-[[3,5-difluoro-4-[(3,4,5-trifluorophenyl)methoxy]phenoxy]-difluoromethyl]-3,5-difluorophenyl]phenyl]-5-pentyl-1,3-dioxane |
| SMILES | CCCCCC1COC(c2ccc(-c3cc(F)c(C(F)(F)Oc4cc(F)c(OCc5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/C35H29F9O4/c1-2-3-4-5-19-16-46-34(47-17-19)22-8-6-21(7-9-22)23-12-25(36)31(26(37)13-23)35(43,44)48-24-14-29(40)33(30(41)15-24)45-18-20-10-27(38)32(42)28(39)11-20/h6-15,19,34H,2-5,16-18H2,1H3 |
| InChIKey | VWYIQEJPADHBAX-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.60 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|