C25H21F5O3 — CID 130191378
2-[4-[3,5-difluoro-4-[(3,4,5-trifluorophenyl)methoxy]phenyl]phenyl]-5-ethyl-1,3-dioxane (PubChem CID 130191378) has the molecular formula C25H21F5O3 and a molecular weight of 464.43 g/mol. Its IUPAC name is 2-[4-[3,5-difluoro-4-[(3,4,5-trifluorophenyl)methoxy]phenyl]phenyl]-5-ethyl-1,3-dioxane.
| Compound Name | 2-[4-[3,5-difluoro-4-[(3,4,5-trifluorophenyl)methoxy]phenyl]phenyl]-5-ethyl-1,3-dioxane |
|---|---|
| PubChem CID | 130191378 |
| Molecular Formula | C25H21F5O3 |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 2-[4-[3,5-difluoro-4-[(3,4,5-trifluorophenyl)methoxy]phenyl]phenyl]-5-ethyl-1,3-dioxane |
| SMILES | CCC1COC(c2ccc(-c3cc(F)c(OCc4cc(F)c(F)c(F)c4)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/C25H21F5O3/c1-2-14-11-32-25(33-12-14)17-5-3-16(4-6-17)18-9-21(28)24(22(29)10-18)31-13-15-7-19(26)23(30)20(27)8-15/h3-10,14,25H,2,11-13H2,1H3 |
| InChIKey | SSSIUSZOENNVEX-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|