C16H14F3NO2 — CID 129171145
2-[4-(3,4,5-trifluorophenyl)phenyl]-1,3-dioxan-5-amine (PubChem CID 129171145) has the molecular formula C16H14F3NO2 and a molecular weight of 309.29 g/mol. Its IUPAC name is 2-[4-(3,4,5-trifluorophenyl)phenyl]-1,3-dioxan-5-amine.
| Compound Name | 2-[4-(3,4,5-trifluorophenyl)phenyl]-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 129171145 |
| Molecular Formula | C16H14F3NO2 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-[4-(3,4,5-trifluorophenyl)phenyl]-1,3-dioxan-5-amine |
| SMILES | NC1COC(c2ccc(-c3cc(F)c(F)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/C16H14F3NO2/c17-13-5-11(6-14(18)15(13)19)9-1-3-10(4-2-9)16-21-7-12(20)8-22-16/h1-6,12,16H,7-8,20H2 |
| InChIKey | IGMODOYUFGAAKK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|