C23H16F6O2S — CID 134447882
2-[4-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]-3-fluorophenyl]phenyl]-1,3-dioxane-5-thiol (PubChem CID 134447882) has the molecular formula C23H16F6O2S and a molecular weight of 470.43 g/mol. Its IUPAC name is 2-[4-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]-3-fluorophenyl]phenyl]-1,3-dioxane-5-thiol.
| Compound Name | 2-[4-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]-3-fluorophenyl]phenyl]-1,3-dioxane-5-thiol |
|---|---|
| PubChem CID | 134447882 |
| Molecular Formula | C23H16F6O2S |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 2-[4-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]-3-fluorophenyl]phenyl]-1,3-dioxane-5-thiol |
| SMILES | Fc1cc(-c2ccc(C3OCC(S)CO3)cc2)ccc1-c1cc(F)c(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C23H16F6O2S/c24-18-7-14(12-1-3-13(4-2-12)22-30-10-16(32)11-31-22)5-6-17(18)15-8-19(25)21(20(26)9-15)23(27,28)29/h1-9,16,22,32H,10-11H2 |
| InChIKey | DXOHSBUFXVWFHE-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|