C17H15F3O3S — CID 129170938
2-[4-[4-(trifluoromethoxy)phenyl]phenyl]-1,3-dioxane-5-thiol (PubChem CID 129170938) has the molecular formula C17H15F3O3S and a molecular weight of 356.37 g/mol. Its IUPAC name is 2-[4-[4-(trifluoromethoxy)phenyl]phenyl]-1,3-dioxane-5-thiol.
| Compound Name | 2-[4-[4-(trifluoromethoxy)phenyl]phenyl]-1,3-dioxane-5-thiol |
|---|---|
| PubChem CID | 129170938 |
| Molecular Formula | C17H15F3O3S |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 2-[4-[4-(trifluoromethoxy)phenyl]phenyl]-1,3-dioxane-5-thiol |
| SMILES | FC(F)(F)Oc1ccc(-c2ccc(C3OCC(S)CO3)cc2)cc1 |
| InChI | InChI=1S/C17H15F3O3S/c18-17(19,20)23-14-7-5-12(6-8-14)11-1-3-13(4-2-11)16-21-9-15(24)10-22-16/h1-8,15-16,24H,9-10H2 |
| InChIKey | WODVSNQLBMCGJB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|