C22H16F4O2S — CID 135161744
2-[4-[4-(3,4-difluorophenyl)-3-fluorophenyl]-3-fluorophenyl]-1,3-dioxane-5-thiol (PubChem CID 135161744) has the molecular formula C22H16F4O2S and a molecular weight of 420.43 g/mol. Its IUPAC name is 2-[4-[4-(3,4-difluorophenyl)-3-fluorophenyl]-3-fluorophenyl]-1,3-dioxane-5-thiol.
| Compound Name | 2-[4-[4-(3,4-difluorophenyl)-3-fluorophenyl]-3-fluorophenyl]-1,3-dioxane-5-thiol |
|---|---|
| PubChem CID | 135161744 |
| Molecular Formula | C22H16F4O2S |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 2-[4-[4-(3,4-difluorophenyl)-3-fluorophenyl]-3-fluorophenyl]-1,3-dioxane-5-thiol |
| SMILES | Fc1ccc(-c2ccc(-c3ccc(C4OCC(S)CO4)cc3F)cc2F)cc1F |
| InChI | InChI=1S/C22H16F4O2S/c23-18-6-3-13(8-21(18)26)16-4-1-12(7-19(16)24)17-5-2-14(9-20(17)25)22-27-10-15(29)11-28-22/h1-9,15,22,29H,10-11H2 |
| InChIKey | YUUWELSEMSYEJD-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|