C34H30F6O3 — CID 59329563
2-[4-[[4-[4-(3,4-difluorophenyl)-3-fluorophenyl]phenoxy]-difluoromethyl]-3-fluorophenyl]-5-pentyl-1,3-dioxane (PubChem CID 59329563) has the molecular formula C34H30F6O3 and a molecular weight of 600.60 g/mol. Its IUPAC name is 2-[4-[[4-[4-(3,4-difluorophenyl)-3-fluorophenyl]phenoxy]-difluoromethyl]-3-fluorophenyl]-5-pentyl-1,3-dioxane.
| Compound Name | 2-[4-[[4-[4-(3,4-difluorophenyl)-3-fluorophenyl]phenoxy]-difluoromethyl]-3-fluorophenyl]-5-pentyl-1,3-dioxane |
|---|---|
| PubChem CID | 59329563 |
| Molecular Formula | C34H30F6O3 |
| Molecular Weight | 600.60 g/mol |
| Exact Mass | 600.21 |
| IUPAC Name | 2-[4-[[4-[4-(3,4-difluorophenyl)-3-fluorophenyl]phenoxy]-difluoromethyl]-3-fluorophenyl]-5-pentyl-1,3-dioxane |
| SMILES | CCCCCC1COC(c2ccc(C(F)(F)Oc3ccc(-c4ccc(-c5ccc(F)c(F)c5)c(F)c4)cc3)c(F)c2)OC1 |
| InChI | InChI=1S/C34H30F6O3/c1-2-3-4-5-21-19-41-33(42-20-21)25-9-14-28(31(37)18-25)34(39,40)43-26-11-6-22(7-12-26)23-8-13-27(30(36)16-23)24-10-15-29(35)32(38)17-24/h6-18,21,33H,2-5,19-20H2,1H3 |
| InChIKey | OAGHNMGPQDYPNO-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.60 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|