C33H27F7O4 — CID 59330129
5-butoxy-2-[4-[[4-[4-(3,4-difluorophenyl)-3-fluorophenyl]phenoxy]-difluoromethyl]-3,5-difluorophenyl]-1,3-dioxane (PubChem CID 59330129) has the molecular formula C33H27F7O4 and a molecular weight of 620.56 g/mol. Its IUPAC name is 5-butoxy-2-[4-[[4-[4-(3,4-difluorophenyl)-3-fluorophenyl]phenoxy]-difluoromethyl]-3,5-difluorophenyl]-1,3-dioxane.
| Compound Name | 5-butoxy-2-[4-[[4-[4-(3,4-difluorophenyl)-3-fluorophenyl]phenoxy]-difluoromethyl]-3,5-difluorophenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 59330129 |
| Molecular Formula | C33H27F7O4 |
| Molecular Weight | 620.56 g/mol |
| Exact Mass | 620.18 |
| IUPAC Name | 5-butoxy-2-[4-[[4-[4-(3,4-difluorophenyl)-3-fluorophenyl]phenoxy]-difluoromethyl]-3,5-difluorophenyl]-1,3-dioxane |
| SMILES | CCCCOC1COC(c2cc(F)c(C(F)(F)Oc3ccc(-c4ccc(-c5ccc(F)c(F)c5)c(F)c4)cc3)c(F)c2)OC1 |
| InChI | InChI=1S/C33H27F7O4/c1-2-3-12-41-24-17-42-32(43-18-24)22-15-29(37)31(30(38)16-22)33(39,40)44-23-8-4-19(5-9-23)20-6-10-25(27(35)13-20)21-7-11-26(34)28(36)14-21/h4-11,13-16,24,32H,2-3,12,17-18H2,1H3 |
| InChIKey | RYAZHBBHSQRWHU-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.56 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|