C35H30F8O3 — CID 59328997
2-[4-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]phenyl]-5-hexyl-1,3-dioxane (PubChem CID 59328997) has the molecular formula C35H30F8O3 and a molecular weight of 650.61 g/mol. Its IUPAC name is 2-[4-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]phenyl]-5-hexyl-1,3-dioxane.
| Compound Name | 2-[4-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]phenyl]-5-hexyl-1,3-dioxane |
|---|---|
| PubChem CID | 59328997 |
| Molecular Formula | C35H30F8O3 |
| Molecular Weight | 650.61 g/mol |
| Exact Mass | 650.21 |
| IUPAC Name | 2-[4-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-3-fluorophenyl]phenyl]-5-hexyl-1,3-dioxane |
| SMILES | CCCCCCC1COC(c2ccc(-c3ccc(-c4cc(F)c(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/C35H30F8O3/c1-2-3-4-5-6-20-18-44-34(45-19-20)22-9-7-21(8-10-22)23-11-12-26(27(36)13-23)24-14-28(37)32(29(38)15-24)35(42,43)46-25-16-30(39)33(41)31(40)17-25/h7-17,20,34H,2-6,18-19H2,1H3 |
| InChIKey | RZLMTZWDMVVXBL-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.61 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|