C37H29F13O3 — CID 59329721
2-[4-[[4-[4-[3,5-difluoro-4-(1,1,2,3,3,3-hexafluoropropyl)phenyl]-3-fluorophenyl]-3-fluorophenoxy]-difluoromethyl]-3-fluorophenyl]-5-pentyl-1,3-dioxane (PubChem CID 59329721) has the molecular formula C37H29F13O3 and a molecular weight of 768.61 g/mol. Its IUPAC name is 2-[4-[[4-[4-[3,5-difluoro-4-(1,1,2,3,3,3-hexafluoropropyl)phenyl]-3-fluorophenyl]-3-fluorophenoxy]-difluoromethyl]-3-fluorophenyl]-5-pentyl-1,3-dioxane.
| Compound Name | 2-[4-[[4-[4-[3,5-difluoro-4-(1,1,2,3,3,3-hexafluoropropyl)phenyl]-3-fluorophenyl]-3-fluorophenoxy]-difluoromethyl]-3-fluorophenyl]-5-pentyl-1,3-dioxane |
|---|---|
| PubChem CID | 59329721 |
| Molecular Formula | C37H29F13O3 |
| Molecular Weight | 768.61 g/mol |
| Exact Mass | 768.19 |
| IUPAC Name | 2-[4-[[4-[4-[3,5-difluoro-4-(1,1,2,3,3,3-hexafluoropropyl)phenyl]-3-fluorophenyl]-3-fluorophenoxy]-difluoromethyl]-3-fluorophenyl]-5-pentyl-1,3-dioxane |
| SMILES | CCCCCC1COC(c2ccc(C(F)(F)Oc3ccc(-c4ccc(-c5cc(F)c(C(F)(F)C(F)C(F)(F)F)c(F)c5)c(F)c4)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C37H29F13O3/c1-2-3-4-5-19-17-51-33(52-18-19)21-7-11-26(29(40)13-21)37(49,50)53-23-8-10-24(28(39)16-23)20-6-9-25(27(38)12-20)22-14-30(41)32(31(42)15-22)35(44,45)34(43)36(46,47)48/h6-16,19,33-34H,2-5,17-18H2,1H3 |
| InChIKey | SYEFRWSOGBHZER-UHFFFAOYSA-N |
| XLogP | 12.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.61 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|