C19H18F4O2 — CID 54250531
2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-propyl-1,3-dioxane (PubChem CID 54250531) has the molecular formula C19H18F4O2 and a molecular weight of 354.34 g/mol. Its IUPAC name is 2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-propyl-1,3-dioxane.
| Compound Name | 2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-propyl-1,3-dioxane |
|---|---|
| PubChem CID | 54250531 |
| Molecular Formula | C19H18F4O2 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-propyl-1,3-dioxane |
| SMILES | CCCC1COC(c2ccc(-c3cc(F)c(F)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C19H18F4O2/c1-2-3-11-9-24-19(25-10-11)12-4-5-14(15(20)6-12)13-7-16(21)18(23)17(22)8-13/h4-8,11,19H,2-3,9-10H2,1H3 |
| InChIKey | QWKLAXRYUGIUOS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|