C22H24F4O3 — CID 134222335
2-[4-[3,5-difluoro-4-(fluoromethoxy)phenyl]-3-fluorophenyl]-5-pentyl-1,3-dioxane (PubChem CID 134222335) has the molecular formula C22H24F4O3 and a molecular weight of 412.42 g/mol. Its IUPAC name is 2-[4-[3,5-difluoro-4-(fluoromethoxy)phenyl]-3-fluorophenyl]-5-pentyl-1,3-dioxane.
| Compound Name | 2-[4-[3,5-difluoro-4-(fluoromethoxy)phenyl]-3-fluorophenyl]-5-pentyl-1,3-dioxane |
|---|---|
| PubChem CID | 134222335 |
| Molecular Formula | C22H24F4O3 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 2-[4-[3,5-difluoro-4-(fluoromethoxy)phenyl]-3-fluorophenyl]-5-pentyl-1,3-dioxane |
| SMILES | CCCCCC1COC(c2ccc(-c3cc(F)c(OCF)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C22H24F4O3/c1-2-3-4-5-14-11-27-22(28-12-14)15-6-7-17(18(24)8-15)16-9-19(25)21(29-13-23)20(26)10-16/h6-10,14,22H,2-5,11-13H2,1H3 |
| InChIKey | ALPGPXCYNMVZNP-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|